CAS 652981-44-7 is the registry number for 2-(2-((tert-Butoxycarbonyl)amino)-5-methylthiazol-4-yl)acetic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2-[5-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]-1,3-thiazol-4-yl]acetic acid (CAS 652981-44-7) is a chemical compound with the molecular formula C11H16N2O4S and a molecular weight of 272.32 g/mol. IUPAC name: 2-[5-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]-1,3-thiazol-4-yl]acetic acid. InChIKey: BCAZJICOTZELBK-UHFFFAOYSA-N.
| Molecular formula | C11H16N2O4S |
|---|---|
| Molecular weight | 272.32 g/mol |
| IUPAC name | 2-[5-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]-1,3-thiazol-4-yl]acetic acid |
| InChIKey | BCAZJICOTZELBK-UHFFFAOYSA-N |
| SMILES | CC1=C(N=C(S1)NC(=O)OC(C)(C)C)CC(=O)O |
Computed by PubChem (NCBI)