Products 654-98-8
CAS 654-98-8 appears in our catalog under these names: 5-Chloro-2-(trifluoromethyl)benzoic acid, 98%, 98%, 5–Chloro–2–(trifluoromethyl)benzoic acid, 5-Chloro-2-(trifluoromethyl)benzoic acid, 97%. Offered by: Chemat, GLPBio, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 25g, 10g.
5-chloro-2-(trifluoromethyl)benzoic acid (CAS 654-98-8) is a chemical compound with the molecular formula C8H4ClF3O2 and a molecular weight of 224.56 g/mol. IUPAC name: 5-chloro-2-(trifluoromethyl)benzoic acid. InChIKey: FWLFUSUVWNEKRN-UHFFFAOYSA-N.
| Molecular formula | C8H4ClF3O2 |
|---|---|
| Molecular weight | 224.56 g/mol |
| IUPAC name | 5-chloro-2-(trifluoromethyl)benzoic acid |
| InChIKey | FWLFUSUVWNEKRN-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)C(=O)O)C(F)(F)F |
Computed by PubChem (NCBI)