Products 65439-88-5
CAS 65439-88-5 is the registry number for 1-(4-Nitrophenyl)-1H-indole-3-carbaldehyde. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
1-(4-nitrophenyl)indole-3-carbaldehyde (CAS 65439-88-5) is a chemical compound with the molecular formula C15H10N2O3 and a molecular weight of 266.25 g/mol. IUPAC name: 1-(4-nitrophenyl)indole-3-carbaldehyde. InChIKey: WHHGIGBKDCWEQP-UHFFFAOYSA-N.
| Molecular formula | C15H10N2O3 |
|---|---|
| Molecular weight | 266.25 g/mol |
| IUPAC name | 1-(4-nitrophenyl)indole-3-carbaldehyde |
| InChIKey | WHHGIGBKDCWEQP-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CN2C3=CC=C(C=C3)[N+](=O)[O-])C=O |
Computed by PubChem (NCBI)