CAS 65461-91-8 appears in our catalog under these names: 3,3'–Azanediyldiphenol, 3,3'-Azanediyldiphenol 95%, 3,3'-Dihydroxydiphenylamine, 95%, 95%, 3,3'-Azanediyldiphenol, 95%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg, 5g.
3-(3-hydroxyanilino)phenol (CAS 65461-91-8) is a chemical compound with the molecular formula C12H11NO2 and a molecular weight of 201.22 g/mol. IUPAC name: 3-(3-hydroxyanilino)phenol. InChIKey: JSQGOXTYKZBABW-UHFFFAOYSA-N.
| Molecular formula | C12H11NO2 |
|---|---|
| Molecular weight | 201.22 g/mol |
| IUPAC name | 3-(3-hydroxyanilino)phenol |
| InChIKey | JSQGOXTYKZBABW-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)O)NC2=CC(=CC=C2)O |
Computed by PubChem (NCBI)