CAS 655223-09-9 appears in our catalog under these names: (4-Chlorophenyl)(prop-2-ynyloxy)acetic Acid, 2-(4-Chlorophenyl)-2-(prop-2-yn-1-yloxy)acetic acid, 95%, 95%. Offered by: TRC, Chemat. Available pack sizes: 100mg, 50mg.
2-(4-chlorophenyl)-2-prop-2-ynoxyacetic acid (CAS 655223-09-9) is a chemical compound with the molecular formula C11H9ClO3 and a molecular weight of 224.64 g/mol. IUPAC name: 2-(4-chlorophenyl)-2-prop-2-ynoxyacetic acid. InChIKey: UODLIGAEPGYRCI-UHFFFAOYSA-N.
| Molecular formula | C11H9ClO3 |
|---|---|
| Molecular weight | 224.64 g/mol |
| IUPAC name | 2-(4-chlorophenyl)-2-prop-2-ynoxyacetic acid |
| InChIKey | UODLIGAEPGYRCI-UHFFFAOYSA-N |
| SMILES | C#CCOC(C1=CC=C(C=C1)Cl)C(=O)O |
Computed by PubChem (NCBI)