Products 65619-31-0
CAS 65619-31-0 is the registry number for 1-(2,4-Dichlorophenyl)-4-oxocyclohexanecarbonitrile, ≥95%. Offered by: Chemat. Available pack sizes: 100mg.
1-(2,4-dichlorophenyl)-4-oxocyclohexane-1-carbonitrile (CAS 65619-31-0) is a chemical compound with the molecular formula C13H11Cl2NO and a molecular weight of 268.13 g/mol. IUPAC name: 1-(2,4-dichlorophenyl)-4-oxocyclohexane-1-carbonitrile. InChIKey: OUKRPSQXZBCMEC-UHFFFAOYSA-N.
| Molecular formula | C13H11Cl2NO |
|---|---|
| Molecular weight | 268.13 g/mol |
| IUPAC name | 1-(2,4-dichlorophenyl)-4-oxocyclohexane-1-carbonitrile |
| InChIKey | OUKRPSQXZBCMEC-UHFFFAOYSA-N |
| SMILES | C1CC(CCC1=O)(C#N)C2=C(C=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)