Products 656801-64-8

CAS 656801-64-8 is the registry number for Methyl 3-isocyanatopicolinate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

Methyl 3-isocyanatopyridine-2-carboxylate (CAS 656801-64-8) is a chemical compound with the molecular formula C8H6N2O3 and a molecular weight of 178.14 g/mol. IUPAC name: methyl 3-isocyanatopyridine-2-carboxylate. InChIKey: VMKIPSCJTYKHQO-UHFFFAOYSA-N.

Identity
Molecular formulaC8H6N2O3
Molecular weight178.14 g/mol
IUPAC namemethyl 3-isocyanatopyridine-2-carboxylate
InChIKeyVMKIPSCJTYKHQO-UHFFFAOYSA-N
SMILESCOC(=O)C1=C(C=CC=N1)N=C=O

Computed by PubChem (NCBI)