CAS 6577-89-5 appears in our catalog under these names: 3-Methyl-4-oxo-4,5,6,7-tetrahydro-1h-indole-2-carboxylic acid, 95%, 3-Methyl-4-oxo-4,5,6,7-tetrahydro-1H-indole-2-carboxylic acid, 97%, 3-Methyl-4-oxo-4,5,6,7-tetrahydro-1H-indole-2-carboxylic acid, 3-Methyl-4-oxo-4,5,6,7-tetrahydro-1h-indole-2-carboxylic acid, 95%, 95%. Offered by: Combi-blocks, AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 10g, 100mg.
3-methyl-4-oxo-1,5,6,7-tetrahydroindole-2-carboxylic acid (CAS 6577-89-5) is a chemical compound with the molecular formula C10H11NO3 and a molecular weight of 193.20 g/mol. IUPAC name: 3-methyl-4-oxo-1,5,6,7-tetrahydroindole-2-carboxylic acid. InChIKey: ZMEOOHFAIWNZLT-UHFFFAOYSA-N.
| Molecular formula | C10H11NO3 |
|---|---|
| Molecular weight | 193.20 g/mol |
| IUPAC name | 3-methyl-4-oxo-1,5,6,7-tetrahydroindole-2-carboxylic acid |
| InChIKey | ZMEOOHFAIWNZLT-UHFFFAOYSA-N |
| SMILES | CC1=C(NC2=C1C(=O)CCC2)C(=O)O |
Computed by PubChem (NCBI)