CAS 6582-45-2 appears in our catalog under these names: 1-(3,4-Dichlorophenyl)butan-1-one, 95+%, 1-(3,4-Dichlorophenyl)butan-1-one. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
1-(3,4-dichlorophenyl)butan-1-one (CAS 6582-45-2) is a chemical compound with the molecular formula C10H10Cl2O and a molecular weight of 217.09 g/mol. IUPAC name: 1-(3,4-dichlorophenyl)butan-1-one. InChIKey: GLWFMNWVTNHDEO-UHFFFAOYSA-N.
| Molecular formula | C10H10Cl2O |
|---|---|
| Molecular weight | 217.09 g/mol |
| IUPAC name | 1-(3,4-dichlorophenyl)butan-1-one |
| InChIKey | GLWFMNWVTNHDEO-UHFFFAOYSA-N |
| SMILES | CCCC(=O)C1=CC(=C(C=C1)Cl)Cl |
Computed by PubChem (NCBI)