CAS 658683-12-6 appears in our catalog under these names: 2-(1-Amino-ethyl)-benzoic acid hydrochloride, 95%, 2–(1–Aminoethyl)benzoic acid hydrochloride, Benzoic acid, 2-(1-aminoethyl)-, hydrochloride (1:1), 96%, 96%, 2-(1-Aminoethyl)benzoic acid hydrochloride, 96%, 2-(1-Aminoethyl)benzoic acid hydrochloride, 95%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 5g, 250mg, 100mg, 50mg, 500mg.
2-(1-aminoethyl)benzoic acid;hydrochloride (CAS 658683-12-6) is a chemical compound with the molecular formula C9H12ClNO2 and a molecular weight of 201.65 g/mol. IUPAC name: 2-(1-aminoethyl)benzoic acid;hydrochloride. InChIKey: GEYYPUHNSHAXET-UHFFFAOYSA-N.
| Molecular formula | C9H12ClNO2 |
|---|---|
| Molecular weight | 201.65 g/mol |
| IUPAC name | 2-(1-aminoethyl)benzoic acid;hydrochloride |
| InChIKey | GEYYPUHNSHAXET-UHFFFAOYSA-N |
| SMILES | CC(C1=CC=CC=C1C(=O)O)N.Cl |
Computed by PubChem (NCBI)