CAS 65870-51-1 appears in our catalog under these names: Cefalexin Impurity 1, Cefalexin Impurity 21, 3-(Aminomethylene)-6-phenyl-2,5-piperazinedione. Offered by: Chemat Brand, TRC, Biosynth. Available pack sizes: on request, 5mg, 10mg, 25mg, 50mg.
3-(aminomethylidene)-6-phenylpiperazine-2,5-dione (CAS 65870-51-1) is a chemical compound with the molecular formula C11H11N3O2 and a molecular weight of 217.22 g/mol. IUPAC name: 3-(aminomethylidene)-6-phenylpiperazine-2,5-dione. InChIKey: HLLOSDFSDKAWTR-UHFFFAOYSA-N.
| Molecular formula | C11H11N3O2 |
|---|---|
| Molecular weight | 217.22 g/mol |
| IUPAC name | 3-(aminomethylidene)-6-phenylpiperazine-2,5-dione |
| InChIKey | HLLOSDFSDKAWTR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2C(=O)NC(=CN)C(=O)N2 |
Computed by PubChem (NCBI)