CAS 6597-30-4 is the registry number for 3,4,5-Trimethoxy-N-methyl-N-phenylbenzamide, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
3,4,5-trimethoxy-N-methyl-N-phenylbenzamide (CAS 6597-30-4) is a chemical compound with the molecular formula C17H19NO4 and a molecular weight of 301.34 g/mol. IUPAC name: 3,4,5-trimethoxy-N-methyl-N-phenylbenzamide. InChIKey: NRALVZBNGKLSOA-UHFFFAOYSA-N.
| Molecular formula | C17H19NO4 |
|---|---|
| Molecular weight | 301.34 g/mol |
| IUPAC name | 3,4,5-trimethoxy-N-methyl-N-phenylbenzamide |
| InChIKey | NRALVZBNGKLSOA-UHFFFAOYSA-N |
| SMILES | CN(C1=CC=CC=C1)C(=O)C2=CC(=C(C(=C2)OC)OC)OC |
Computed by PubChem (NCBI)