Products 659731-29-0
CAS 659731-29-0 is the registry number for (2,2-Dimethyl-2,3-dihydrobenzofuran-6-yl)boronic acid, 98%. Offered by: Ambeed. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 250mg, 1g.
(2,2-dimethyl-3H-1-benzofuran-6-yl)boronic acid (CAS 659731-29-0) is a chemical compound with the molecular formula C10H13BO3 and a molecular weight of 192.02 g/mol. IUPAC name: (2,2-dimethyl-3H-1-benzofuran-6-yl)boronic acid. InChIKey: DDHYGHDRSUSCQH-UHFFFAOYSA-N.
| Molecular formula | C10H13BO3 |
|---|---|
| Molecular weight | 192.02 g/mol |
| IUPAC name | (2,2-dimethyl-3H-1-benzofuran-6-yl)boronic acid |
| InChIKey | DDHYGHDRSUSCQH-UHFFFAOYSA-N |
| SMILES | B(C1=CC2=C(CC(O2)(C)C)C=C1)(O)O |
Computed by PubChem (NCBI)