CAS 660416-39-7 appears in our catalog under these names: 5-(Chloromethyl)-3-(3-methoxyphenyl)-1,2,4-oxadiazole, 98%, 5-(Chloromethyl)-3-(3-methoxyphenyl)-1,2,4-oxadiazole, 5-Chloromethyl-3-(3-methoxy-phenyl)-[1,2,4]oxadiazole, 95%. Offered by: Combi-blocks, Biosynth, Fluorochem. Available pack sizes: 1g, 5g, 2,5g.
5-(chloromethyl)-3-(3-methoxyphenyl)-1,2,4-oxadiazole (CAS 660416-39-7) is a chemical compound with the molecular formula C10H9ClN2O2 and a molecular weight of 224.64 g/mol. IUPAC name: 5-(chloromethyl)-3-(3-methoxyphenyl)-1,2,4-oxadiazole. InChIKey: WCKMMCGTGZMQBY-UHFFFAOYSA-N.
| Molecular formula | C10H9ClN2O2 |
|---|---|
| Molecular weight | 224.64 g/mol |
| IUPAC name | 5-(chloromethyl)-3-(3-methoxyphenyl)-1,2,4-oxadiazole |
| InChIKey | WCKMMCGTGZMQBY-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC(=C1)C2=NOC(=N2)CCl |
Computed by PubChem (NCBI)