CAS 6622-28-2 is the registry number for 4,7-Dichloro-3-methylquinoline. Offered by: TRC. Available pack sizes: 100mg.
4,7-dichloro-3-methylquinoline (CAS 6622-28-2) is a chemical compound with the molecular formula C10H7Cl2N and a molecular weight of 212.07 g/mol. IUPAC name: 4,7-dichloro-3-methylquinoline. InChIKey: LBMPXLFXMLLVSN-UHFFFAOYSA-N.
| Molecular formula | C10H7Cl2N |
|---|---|
| Molecular weight | 212.07 g/mol |
| IUPAC name | 4,7-dichloro-3-methylquinoline |
| InChIKey | LBMPXLFXMLLVSN-UHFFFAOYSA-N |
| SMILES | CC1=CN=C2C=C(C=CC2=C1Cl)Cl |
Computed by PubChem (NCBI)