Products 6624-48-2
CAS 6624-48-2 is the registry number for Rasagiline Impurity 11. Offered by: Chemat Brand. Available pack sizes: on request.
(NZ)-N-[(3E)-3-hydroxyiminoinden-1-ylidene]hydroxylamine (CAS 6624-48-2) is a chemical compound with the molecular formula C9H8N2O2 and a molecular weight of 176.17 g/mol. IUPAC name: (NZ)-N-[(3E)-3-hydroxyiminoinden-1-ylidene]hydroxylamine. InChIKey: VPQPJUDANCCIRW-PNQPDEHRSA-N.
| Molecular formula | C9H8N2O2 |
|---|---|
| Molecular weight | 176.17 g/mol |
| IUPAC name | (NZ)-N-[(3E)-3-hydroxyiminoinden-1-ylidene]hydroxylamine |
| InChIKey | VPQPJUDANCCIRW-PNQPDEHRSA-N |
| SMILES | C\1/C(=N\O)/C2=CC=CC=C2/C1=N\O |
Computed by PubChem (NCBI)