CAS 66410-92-2 appears in our catalog under these names: 7-Amino-2,3-dihydro-1,4-benzodioxine-5-carboxylic acid, 95%, 7-Amino-2,3-dihydro-1,4-benzodioxine-5-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
7-amino-2,3-dihydro-1,4-benzodioxine-5-carboxylic acid (CAS 66410-92-2) is a chemical compound with the molecular formula C9H9NO4 and a molecular weight of 195.17 g/mol. IUPAC name: 7-amino-2,3-dihydro-1,4-benzodioxine-5-carboxylic acid. InChIKey: FSRYNXDRMYDGKD-UHFFFAOYSA-N.
| Molecular formula | C9H9NO4 |
|---|---|
| Molecular weight | 195.17 g/mol |
| IUPAC name | 7-amino-2,3-dihydro-1,4-benzodioxine-5-carboxylic acid |
| InChIKey | FSRYNXDRMYDGKD-UHFFFAOYSA-N |
| SMILES | C1COC2=C(C=C(C=C2O1)N)C(=O)O |
Computed by PubChem (NCBI)