Products 664364-29-8
CAS 664364-29-8 appears in our catalog under these names: Ethyl 1-boc-3-pyrrolidine acetate, 97%, tert–Butyl 3–(2–ethoxy–2–oxoethyl)pyrrolidine–1–carboxylate, ethyl 1-boc-3-pyrrolidine acetate, tert-Butyl 3-(2-ethoxy-2-oxoethyl)pyrrolidine-1-carboxylate 95%, tert-Butyl 3-(2-ethoxy-2-oxoethyl)pyrrolidine-1-carboxylate, 97%, 97%. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 10g, 25g, 5g, 1g, 100mg, 250mg.
Tert-butyl 3-(2-ethoxy-2-oxoethyl)pyrrolidine-1-carboxylate (CAS 664364-29-8) is a chemical compound with the molecular formula C13H23NO4 and a molecular weight of 257.33 g/mol. IUPAC name: tert-butyl 3-(2-ethoxy-2-oxoethyl)pyrrolidine-1-carboxylate. InChIKey: PIDOQUSXCYDMQD-UHFFFAOYSA-N.
| Molecular formula | C13H23NO4 |
|---|---|
| Molecular weight | 257.33 g/mol |
| IUPAC name | tert-butyl 3-(2-ethoxy-2-oxoethyl)pyrrolidine-1-carboxylate |
| InChIKey | PIDOQUSXCYDMQD-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CC1CCN(C1)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)