CAS 6668-24-2 appears in our catalog under these names: 2–Methyl–1–phenylbutane–1,3–dione, 2-Methyl-1-phenylbutane-1,3-dione, 2-Methyl-1-phenylbutane-1,3-dione 97%, 2-Methyl-1-phenylbutane-1,3-dione, 98%, 1-Phenyl-2-methyl-1,3-butanedione, 95%, 95%. Offered by: GLPBio, Biosynth, Ambeed, Fluorochem, Chemat. Available pack sizes: 1g, 250mg, 50mg, 5g, 2,5g, 10g.
2-methyl-1-phenylbutane-1,3-dione (CAS 6668-24-2) is a chemical compound with the molecular formula C11H12O2 and a molecular weight of 176.21 g/mol. IUPAC name: 2-methyl-1-phenylbutane-1,3-dione. InChIKey: IRNJRGVFXLVQEK-UHFFFAOYSA-N.
| Molecular formula | C11H12O2 |
|---|---|
| Molecular weight | 176.21 g/mol |
| IUPAC name | 2-methyl-1-phenylbutane-1,3-dione |
| InChIKey | IRNJRGVFXLVQEK-UHFFFAOYSA-N |
| SMILES | CC(C(=O)C)C(=O)C1=CC=CC=C1 |
Computed by PubChem (NCBI)