Products 668970-55-6
CAS 668970-55-6 appears in our catalog under these names: 4-Bromo-2-fluoromandelic acid, 4-Bromo-2-fluoromandelic acid, 99.0%. Offered by: Biosynth, Fluorochem. Available pack sizes: 1g, 10g, 250mg, 500mg, 2.5g, 5g.
2-(4-bromo-2-fluorophenyl)-2-hydroxyacetic acid (CAS 668970-55-6) is a chemical compound with the molecular formula C8H6BrFO3 and a molecular weight of 249.03 g/mol. IUPAC name: 2-(4-bromo-2-fluorophenyl)-2-hydroxyacetic acid. InChIKey: FAMRTHHQYMFCBD-UHFFFAOYSA-N.
| Molecular formula | C8H6BrFO3 |
|---|---|
| Molecular weight | 249.03 g/mol |
| IUPAC name | 2-(4-bromo-2-fluorophenyl)-2-hydroxyacetic acid |
| InChIKey | FAMRTHHQYMFCBD-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Br)F)C(C(=O)O)O |
Computed by PubChem (NCBI)