CAS 668970-85-2 appears in our catalog under these names: 5-(4-(Trifluoromethyl)phenyl)isoxazole-3-carboxylic acid, 97%, 5-(4-(Trifluoromethyl)phenyl)isoxazole-3-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
5-[4-(trifluoromethyl)phenyl]-1,2-oxazole-3-carboxylic acid (CAS 668970-85-2) is a chemical compound with the molecular formula C11H6F3NO3 and a molecular weight of 257.16 g/mol. IUPAC name: 5-[4-(trifluoromethyl)phenyl]-1,2-oxazole-3-carboxylic acid. InChIKey: RILMWGDLHDRILD-UHFFFAOYSA-N.
| Molecular formula | C11H6F3NO3 |
|---|---|
| Molecular weight | 257.16 g/mol |
| IUPAC name | 5-[4-(trifluoromethyl)phenyl]-1,2-oxazole-3-carboxylic acid |
| InChIKey | RILMWGDLHDRILD-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC(=NO2)C(=O)O)C(F)(F)F |
Computed by PubChem (NCBI)