Products 668970-85-2

CAS 668970-85-2 appears in our catalog under these names: 5-(4-(Trifluoromethyl)phenyl)isoxazole-3-carboxylic acid, 97%, 5-(4-(Trifluoromethyl)phenyl)isoxazole-3-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.

Structural formula: {0} (CAS {1})

5-[4-(trifluoromethyl)phenyl]-1,2-oxazole-3-carboxylic acid (CAS 668970-85-2) is a chemical compound with the molecular formula C11H6F3NO3 and a molecular weight of 257.16 g/mol. IUPAC name: 5-[4-(trifluoromethyl)phenyl]-1,2-oxazole-3-carboxylic acid. InChIKey: RILMWGDLHDRILD-UHFFFAOYSA-N.

Identity
Molecular formulaC11H6F3NO3
Molecular weight257.16 g/mol
IUPAC name5-[4-(trifluoromethyl)phenyl]-1,2-oxazole-3-carboxylic acid
InChIKeyRILMWGDLHDRILD-UHFFFAOYSA-N
SMILESC1=CC(=CC=C1C2=CC(=NO2)C(=O)O)C(F)(F)F

Computed by PubChem (NCBI)