CAS 67-36-7 appears in our catalog under these names: 4-Phenoxybenzaldehyde, 4–Phenoxybenzaldehyde, 4-Phenoxybenzaldehyde, 98% , 4-Phenoxybenzaldehyde, >98.0%(GC), 4-Phenoxybenzaldehyde, 98%. Offered by: TRC, GLPBio, Thermo Scientific (Alfa Aesar), Biosynth, TCI. Available pack sizes: 10g, 2,5g, 25g, 5g, 1g, 50g, 100g, 500g.
4-phenoxybenzaldehyde (CAS 67-36-7) is a chemical compound with the molecular formula C13H10O2 and a molecular weight of 198.22 g/mol. IUPAC name: 4-phenoxybenzaldehyde. InChIKey: QWLHJVDRPZNVBS-UHFFFAOYSA-N.
| Molecular formula | C13H10O2 |
|---|---|
| Molecular weight | 198.22 g/mol |
| IUPAC name | 4-phenoxybenzaldehyde |
| InChIKey | QWLHJVDRPZNVBS-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OC2=CC=C(C=C2)C=O |
Computed by PubChem (NCBI)