CAS 67127-84-8 appears in our catalog under these names: 3-Cyano-2-hydroxybenzoic acid, 95%, 3–cyano–2–hydroxybenzoic acid, 3-cyano-2-hydroxybenzoicacid, 3-Cyano-2-hydroxybenzoic acid 98+%, 3-cyano-2-hydroxybenzoic acid, 98+%, 98+%. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 250mg, 1g, 5g, 0,5g, 100mg.
3-cyano-2-hydroxybenzoic acid (CAS 67127-84-8) is a chemical compound with the molecular formula C8H5NO3 and a molecular weight of 163.13 g/mol. IUPAC name: 3-cyano-2-hydroxybenzoic acid. InChIKey: YXONTGXEHMEGFO-UHFFFAOYSA-N.
| Molecular formula | C8H5NO3 |
|---|---|
| Molecular weight | 163.13 g/mol |
| IUPAC name | 3-cyano-2-hydroxybenzoic acid |
| InChIKey | YXONTGXEHMEGFO-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)C(=O)O)O)C#N |
Computed by PubChem (NCBI)