Products 672286-82-7
CAS 672286-82-7 is the registry number for Methyl 3-((3,4-dichlorophenyl)sulfonamido)benzoate, 97+%. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
Methyl 3-[(3,4-dichlorophenyl)sulfonylamino]benzoate (CAS 672286-82-7) is a chemical compound with the molecular formula C14H11Cl2NO4S and a molecular weight of 360.2 g/mol. IUPAC name: methyl 3-[(3,4-dichlorophenyl)sulfonylamino]benzoate. InChIKey: NSQNMQSYVWUCCW-UHFFFAOYSA-N.
| Molecular formula | C14H11Cl2NO4S |
|---|---|
| Molecular weight | 360.2 g/mol |
| IUPAC name | methyl 3-[(3,4-dichlorophenyl)sulfonylamino]benzoate |
| InChIKey | NSQNMQSYVWUCCW-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=CC=C1)NS(=O)(=O)C2=CC(=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)