Products 6725-45-7
CAS 6725-45-7 appears in our catalog under these names: Ethyl 2-(3,4-dichlorophenyl)acetate, 97%, Ethyl 3,4-dichlorophenyl acetate, 97%, ETHYL 3,4-DICHLOROPHENYLACETATE, 97%. Offered by: Ambeed, BLDpharm, Fluorochem, Chemat. Available pack sizes: 5g, 25g, 100g.
Ethyl 2-(3,4-dichlorophenyl)acetate (CAS 6725-45-7) is a chemical compound with the molecular formula C10H10Cl2O2 and a molecular weight of 233.09 g/mol. IUPAC name: ethyl 2-(3,4-dichlorophenyl)acetate. InChIKey: QAEBVJIVEPSFRK-UHFFFAOYSA-N.
| Molecular formula | C10H10Cl2O2 |
|---|---|
| Molecular weight | 233.09 g/mol |
| IUPAC name | ethyl 2-(3,4-dichlorophenyl)acetate |
| InChIKey | QAEBVJIVEPSFRK-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CC1=CC(=C(C=C1)Cl)Cl |
Computed by PubChem (NCBI)