CAS 67342-52-3 is the registry number for Azithromycin Impurity 27. Offered by: Chemat Brand. Available pack sizes: on request.
(propan-2-ylideneamino) 4-methylbenzenesulfonate (CAS 67342-52-3) is a chemical compound with the molecular formula C10H13NO3S and a molecular weight of 227.28 g/mol. IUPAC name: (propan-2-ylideneamino) 4-methylbenzenesulfonate. InChIKey: GYOKHDOXHGBGTQ-UHFFFAOYSA-N.
| Molecular formula | C10H13NO3S |
|---|---|
| Molecular weight | 227.28 g/mol |
| IUPAC name | (propan-2-ylideneamino) 4-methylbenzenesulfonate |
| InChIKey | GYOKHDOXHGBGTQ-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)ON=C(C)C |
Computed by PubChem (NCBI)