CAS 6759-80-4 appears in our catalog under these names: 2,5,7-Trimethylquinolin-8-ol, 95%, 2,5,7-Trimethylquinolin-8-ol 95%, 2,5,7-Trimethylquinolin-8-ol, 95%, 95%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg, 5g.
2,5,7-trimethylquinolin-8-ol (CAS 6759-80-4) is a chemical compound with the molecular formula C12H13NO and a molecular weight of 187.24 g/mol. IUPAC name: 2,5,7-trimethylquinolin-8-ol. InChIKey: UPPOGIWKARTVGH-UHFFFAOYSA-N.
| Molecular formula | C12H13NO |
|---|---|
| Molecular weight | 187.24 g/mol |
| IUPAC name | 2,5,7-trimethylquinolin-8-ol |
| InChIKey | UPPOGIWKARTVGH-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(C=C1)C(=CC(=C2O)C)C |
Computed by PubChem (NCBI)