CAS 67666-03-9 is the registry number for Eltrombopag Impurity 23. Offered by: Chemat Brand. Available pack sizes: on request.
1,2-bis(3,4-dimethylphenyl)hydrazine (CAS 67666-03-9) is a chemical compound with the molecular formula C16H20N2 and a molecular weight of 240.34 g/mol. IUPAC name: 1,2-bis(3,4-dimethylphenyl)hydrazine. InChIKey: FWXNGZXYKWNRQM-UHFFFAOYSA-N.
| Molecular formula | C16H20N2 |
|---|---|
| Molecular weight | 240.34 g/mol |
| IUPAC name | 1,2-bis(3,4-dimethylphenyl)hydrazine |
| InChIKey | FWXNGZXYKWNRQM-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)NNC2=CC(=C(C=C2)C)C)C |
Computed by PubChem (NCBI)