CAS 67752-29-8 appears in our catalog under these names: 3-(Quinolin-4-yl)propanoic acid, 3-(Quinolin-4-yl)propanoic acid, 97%, 97%, 3-(Quinolin-4-yl)propanoic acid, 97%. Offered by: Biosynth, Chemat, Fluorochem. Available pack sizes: 0,5g, 50mg, 100mg, 250mg, 1g, 500mg, 2.5g.
3-quinolin-4-ylpropanoic acid (CAS 67752-29-8) is a chemical compound with the molecular formula C12H11NO2 and a molecular weight of 201.22 g/mol. IUPAC name: 3-quinolin-4-ylpropanoic acid. InChIKey: IWJZVWBVDNIJIL-UHFFFAOYSA-N.
| Molecular formula | C12H11NO2 |
|---|---|
| Molecular weight | 201.22 g/mol |
| IUPAC name | 3-quinolin-4-ylpropanoic acid |
| InChIKey | IWJZVWBVDNIJIL-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CC=N2)CCC(=O)O |
Computed by PubChem (NCBI)