CAS 67828-68-6 appears in our catalog under these names: Adrenaline Impurity 8 HCl, Adrenaline Impurity 21. Offered by: Chemat Brand. Available pack sizes: on request.
1-(4-hydroxyphenyl)-2-(methylamino)ethanone;hydrochloride (CAS 67828-68-6) is a chemical compound with the molecular formula C9H12ClNO2 and a molecular weight of 201.65 g/mol. IUPAC name: 1-(4-hydroxyphenyl)-2-(methylamino)ethanone;hydrochloride. InChIKey: FKGNVJPOAYAVNM-UHFFFAOYSA-N.
| Molecular formula | C9H12ClNO2 |
|---|---|
| Molecular weight | 201.65 g/mol |
| IUPAC name | 1-(4-hydroxyphenyl)-2-(methylamino)ethanone;hydrochloride |
| InChIKey | FKGNVJPOAYAVNM-UHFFFAOYSA-N |
| SMILES | CNCC(=O)C1=CC=C(C=C1)O.Cl |
Computed by PubChem (NCBI)