Products 678549-66-1

CAS 678549-66-1 is the registry number for 2-(2-Bromo-6-ethoxy-4-formylphenoxy)acetic acid. Offered by: Biosynth. Available pack sizes: 250mg, 2,5g.

Structural formula: {0} (CAS {1})

2-(2-bromo-6-ethoxy-4-formylphenoxy)acetic acid (CAS 678549-66-1) is a chemical compound with the molecular formula C11H11BrO5 and a molecular weight of 303.11 g/mol. IUPAC name: 2-(2-bromo-6-ethoxy-4-formylphenoxy)acetic acid. InChIKey: VHXPOMCAVDRYDS-UHFFFAOYSA-N.

Identity
Molecular formulaC11H11BrO5
Molecular weight303.11 g/mol
IUPAC name2-(2-bromo-6-ethoxy-4-formylphenoxy)acetic acid
InChIKeyVHXPOMCAVDRYDS-UHFFFAOYSA-N
SMILESCCOC1=C(C(=CC(=C1)C=O)Br)OCC(=O)O

Computed by PubChem (NCBI)