Products 678549-66-1
CAS 678549-66-1 is the registry number for 2-(2-Bromo-6-ethoxy-4-formylphenoxy)acetic acid. Offered by: Biosynth. Available pack sizes: 250mg, 2,5g.
2-(2-bromo-6-ethoxy-4-formylphenoxy)acetic acid (CAS 678549-66-1) is a chemical compound with the molecular formula C11H11BrO5 and a molecular weight of 303.11 g/mol. IUPAC name: 2-(2-bromo-6-ethoxy-4-formylphenoxy)acetic acid. InChIKey: VHXPOMCAVDRYDS-UHFFFAOYSA-N.
| Molecular formula | C11H11BrO5 |
|---|---|
| Molecular weight | 303.11 g/mol |
| IUPAC name | 2-(2-bromo-6-ethoxy-4-formylphenoxy)acetic acid |
| InChIKey | VHXPOMCAVDRYDS-UHFFFAOYSA-N |
| SMILES | CCOC1=C(C(=CC(=C1)C=O)Br)OCC(=O)O |
Computed by PubChem (NCBI)