CAS 678969-88-5 appears in our catalog under these names: 5–Fluoro–2–methoxy–4–nitrobenzaldehyde, 5-Fluoro-2-methoxy-4-nitrobenzaldehyde, 95%. Offered by: GLPBio, Combi-blocks. Available pack sizes: 1g, 250mg.
5-fluoro-2-methoxy-4-nitrobenzaldehyde (CAS 678969-88-5) is a chemical compound with the molecular formula C8H6FNO4 and a molecular weight of 199.14 g/mol. IUPAC name: 5-fluoro-2-methoxy-4-nitrobenzaldehyde. InChIKey: LGLPADRUFKEHBY-UHFFFAOYSA-N.
| Molecular formula | C8H6FNO4 |
|---|---|
| Molecular weight | 199.14 g/mol |
| IUPAC name | 5-fluoro-2-methoxy-4-nitrobenzaldehyde |
| InChIKey | LGLPADRUFKEHBY-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1C=O)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)