CAS 68005-71-0 appears in our catalog under these names: Tosyl–D–valine, Tos-D-Val-OH 98%, Tos-D-Val-OH, 98%, 98%. Offered by: GLPBio, Ambeed, Chemat. Available pack sizes: 1g, 5g, 25g.
(2R)-3-methyl-2-[(4-methylphenyl)sulfonylamino]butanoic acid (CAS 68005-71-0) is a chemical compound with the molecular formula C12H17NO4S and a molecular weight of 271.33 g/mol. IUPAC name: (2R)-3-methyl-2-[(4-methylphenyl)sulfonylamino]butanoic acid. InChIKey: ZYFUNXTYNIYYJI-LLVKDONJSA-N.
| Molecular formula | C12H17NO4S |
|---|---|
| Molecular weight | 271.33 g/mol |
| IUPAC name | (2R)-3-methyl-2-[(4-methylphenyl)sulfonylamino]butanoic acid |
| InChIKey | ZYFUNXTYNIYYJI-LLVKDONJSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)N[C@H](C(C)C)C(=O)O |
Computed by PubChem (NCBI)