CAS 680610-58-6 appears in our catalog under these names: 2,3-Difluoro-n-methoxy-n-methylbenzamide, 97%, 2,3-Difluoro-N-methoxy-N-methylbenzamide, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 25g, 10g, 100g, 5g, 1g.
2,3-difluoro-N-methoxy-N-methylbenzamide (CAS 680610-58-6) is a chemical compound with the molecular formula C9H9F2NO2 and a molecular weight of 201.17 g/mol. IUPAC name: 2,3-difluoro-N-methoxy-N-methylbenzamide. InChIKey: JJGWLXYLNIOSOO-UHFFFAOYSA-N.
| Molecular formula | C9H9F2NO2 |
|---|---|
| Molecular weight | 201.17 g/mol |
| IUPAC name | 2,3-difluoro-N-methoxy-N-methylbenzamide |
| InChIKey | JJGWLXYLNIOSOO-UHFFFAOYSA-N |
| SMILES | CN(C(=O)C1=C(C(=CC=C1)F)F)OC |
Computed by PubChem (NCBI)