Products 68160-71-4
CAS 68160-71-4 is the registry number for Ro 07-1902. Offered by: MedChemExpress. Available pack sizes: Get quote.
1-(2-nitroimidazol-1-yl)-3-[(E)-prop-1-enoxy]propan-2-ol (CAS 68160-71-4) is a chemical compound with the molecular formula C9H13N3O4 and a molecular weight of 227.22 g/mol. IUPAC name: 1-(2-nitroimidazol-1-yl)-3-[(E)-prop-1-enoxy]propan-2-ol. InChIKey: XVAVDAAXADYTPR-GORDUTHDSA-N.
| Molecular formula | C9H13N3O4 |
|---|---|
| Molecular weight | 227.22 g/mol |
| IUPAC name | 1-(2-nitroimidazol-1-yl)-3-[(E)-prop-1-enoxy]propan-2-ol |
| InChIKey | XVAVDAAXADYTPR-GORDUTHDSA-N |
| SMILES | C/C=C/OCC(CN1C=CN=C1[N+](=O)[O-])O |
Computed by PubChem (NCBI)