Products 68189-34-4
CAS 68189-34-4 is the registry number for 2-Chloro-5-(phenylsulfamoyl)benzoic acid. Offered by: Biosynth. Available pack sizes: 250mg, 2,5g.
2-chloro-5-(phenylsulfamoyl)benzoic acid (CAS 68189-34-4) is a chemical compound with the molecular formula C13H10ClNO4S and a molecular weight of 311.74 g/mol. IUPAC name: 2-chloro-5-(phenylsulfamoyl)benzoic acid. InChIKey: BYKANEVMPOZIQF-UHFFFAOYSA-N.
| Molecular formula | C13H10ClNO4S |
|---|---|
| Molecular weight | 311.74 g/mol |
| IUPAC name | 2-chloro-5-(phenylsulfamoyl)benzoic acid |
| InChIKey | BYKANEVMPOZIQF-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)NS(=O)(=O)C2=CC(=C(C=C2)Cl)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
Benzoic acid, 2-chloro-5-[(phenylamino)sulfonyl]-, 2-Chloro-5-phenylsulfamoylbenzoic acid, Benzoic acid, 2-chloro-5-((phenylamino)sulfonyl)-, 2-chloro-5-(phenylsulfamoyl)benzoic acid, 2-chloro-5-[(phenylamino)sulphonyl]benzoic acid, 2-chloro-5-[(phenylamino)sulfonyl]benzoic acid, 2-Chloro-5-((phenylamino)sulphonyl)benzoic acid, BYKANEVMPOZIQF-UHFFFAOYSA-N