Products 682321-46-6
CAS 682321-46-6 appears in our catalog under these names: 2,6-Naphthalenedicarboxylic-d6 Acid, 98 atom % D, min 98% Chemical Purity, Naphthalene-2,6-dicarboxylic acid-d6. Offered by: CDN, MedChemExpress. Available pack sizes: 0,1g, 0,05g, 1 mg, 5 mg, 10 mg.
1,3,4,5,7,8-hexadeuterionaphthalene-2,6-dicarboxylic acid (CAS 682321-46-6) is a chemical compound with the molecular formula C12H8O4 and a molecular weight of 222.23 g/mol. IUPAC name: 1,3,4,5,7,8-hexadeuterionaphthalene-2,6-dicarboxylic acid. InChIKey: RXOHFPCZGPKIRD-MZWXYZOWSA-N.
| Molecular formula | C12H8O4 |
|---|---|
| Molecular weight | 222.23 g/mol |
| IUPAC name | 1,3,4,5,7,8-hexadeuterionaphthalene-2,6-dicarboxylic acid |
| InChIKey | RXOHFPCZGPKIRD-MZWXYZOWSA-N |
| SMILES | [2H]C1=C(C(=C(C2=C1C(=C(C(=C2[2H])[2H])C(=O)O)[2H])[2H])C(=O)O)[2H] |
Computed by PubChem (NCBI)