Products 68245-16-9
CAS 68245-16-9 is the registry number for Enaminomycin C. Offered by: MedChemExpress. Available pack sizes: Get quote.
(1S,5S,6S)-2,5-dihydroxy-4-imino-7-oxabicyclo[4.1.0]hept-2-ene-3-carboxylic acid (CAS 68245-16-9) is a chemical compound with the molecular formula C7H7NO5 and a molecular weight of 185.13 g/mol. IUPAC name: (1S,5S,6S)-2,5-dihydroxy-4-imino-7-oxabicyclo[4.1.0]hept-2-ene-3-carboxylic acid. InChIKey: IFMVUTNKEOCTHY-JKUQZMGJSA-N.
| Molecular formula | C7H7NO5 |
|---|---|
| Molecular weight | 185.13 g/mol |
| IUPAC name | (1S,5S,6S)-2,5-dihydroxy-4-imino-7-oxabicyclo[4.1.0]hept-2-ene-3-carboxylic acid |
| InChIKey | IFMVUTNKEOCTHY-JKUQZMGJSA-N |
| SMILES | [C@H]12[C@H](C(=N)C(=C([C@H]1O2)O)C(=O)O)O |
Computed by PubChem (NCBI)
Synonyms:
Enaminomycin C, orb3024396