CAS 682757-75-1 is the registry number for 5-Amino-2-fluoro-N,N-dimethylbenzamide. Offered by: Biosynth. Available pack sizes: 5g, 0,5g.
5-amino-2-fluoro-N,N-dimethylbenzamide (CAS 682757-75-1) is a chemical compound with the molecular formula C9H11FN2O and a molecular weight of 182.19 g/mol. IUPAC name: 5-amino-2-fluoro-N,N-dimethylbenzamide. InChIKey: OOOQACURFPURSF-UHFFFAOYSA-N.
| Molecular formula | C9H11FN2O |
|---|---|
| Molecular weight | 182.19 g/mol |
| IUPAC name | 5-amino-2-fluoro-N,N-dimethylbenzamide |
| InChIKey | OOOQACURFPURSF-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)C1=C(C=CC(=C1)N)F |
Computed by PubChem (NCBI)