CAS 6828-46-2 is the registry number for Apremilast Impurity 64. Offered by: Chemat Brand. Available pack sizes: on request.
2-ethoxycarbonyl-3-nitrobenzoic acid (CAS 6828-46-2) is a chemical compound with the molecular formula C10H9NO6 and a molecular weight of 239.18 g/mol. IUPAC name: 2-ethoxycarbonyl-3-nitrobenzoic acid. InChIKey: ANIGGJRHTJBCOD-UHFFFAOYSA-N.
| Molecular formula | C10H9NO6 |
|---|---|
| Molecular weight | 239.18 g/mol |
| IUPAC name | 2-ethoxycarbonyl-3-nitrobenzoic acid |
| InChIKey | ANIGGJRHTJBCOD-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C=CC=C1[N+](=O)[O-])C(=O)O |
Computed by PubChem (NCBI)