Products 6828-46-2

CAS 6828-46-2 is the registry number for Apremilast Impurity 64. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-ethoxycarbonyl-3-nitrobenzoic acid (CAS 6828-46-2) is a chemical compound with the molecular formula C10H9NO6 and a molecular weight of 239.18 g/mol. IUPAC name: 2-ethoxycarbonyl-3-nitrobenzoic acid. InChIKey: ANIGGJRHTJBCOD-UHFFFAOYSA-N.

Identity
Molecular formulaC10H9NO6
Molecular weight239.18 g/mol
IUPAC name2-ethoxycarbonyl-3-nitrobenzoic acid
InChIKeyANIGGJRHTJBCOD-UHFFFAOYSA-N
SMILESCCOC(=O)C1=C(C=CC=C1[N+](=O)[O-])C(=O)O

Computed by PubChem (NCBI)