Products 682804-73-5
CAS 682804-73-5 is the registry number for 3-Amino-3-(3,5-difluorophenyl)propanoic acid, 95%. Offered by: AmBeed, Chemat, BLDpharm. Available pack sizes: 5g, 250mg, 1g, 100mg.
3-amino-3-(3,5-difluorophenyl)propanoic acid (CAS 682804-73-5) is a chemical compound with the molecular formula C9H9F2NO2 and a molecular weight of 201.17 g/mol. IUPAC name: 3-amino-3-(3,5-difluorophenyl)propanoic acid. InChIKey: OYIOVKBLAKVZEC-UHFFFAOYSA-N.
| Molecular formula | C9H9F2NO2 |
|---|---|
| Molecular weight | 201.17 g/mol |
| IUPAC name | 3-amino-3-(3,5-difluorophenyl)propanoic acid |
| InChIKey | OYIOVKBLAKVZEC-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1F)F)C(CC(=O)O)N |
Computed by PubChem (NCBI)
Synonyms:
3-amino-3-(3,5-difluorophenyl)propanoic acid, 3-Amino-3-(3,5-difluorophenyl)propionic Acid, 3-Amino-3-(3,5-difluoro-phenyl)-propionic acid, b-Amino-3,5-difluorobenzenepropanoic acid, beta-Amino-3,5-difluorobenzenepropanoic acid, 3-amino-3-(3,5-difluorophenyl)propanoicacid, Benzenepropanoic acid, beta-amino-3,5-difluoro-