Products 68342-51-8
CAS 68342-51-8 appears in our catalog under these names: 3-Amino-2-(phenylsulfonyl)acrylonitrile, 98%, 2-(Aminomethylene)phenylsulphonyl acetonitrile. Offered by: Chemat Brand, Biosynth. Available pack sizes: on request, 2000mg, 1000mg, 5000mg.
3-amino-2-(benzenesulfonyl)prop-2-enenitrile (CAS 68342-51-8) is a chemical compound with the molecular formula C9H8N2O2S and a molecular weight of 208.24 g/mol. IUPAC name: 3-amino-2-(benzenesulfonyl)prop-2-enenitrile. InChIKey: KHHBTMWGMOVXHF-UHFFFAOYSA-N.
| Molecular formula | C9H8N2O2S |
|---|---|
| Molecular weight | 208.24 g/mol |
| IUPAC name | 3-amino-2-(benzenesulfonyl)prop-2-enenitrile |
| InChIKey | KHHBTMWGMOVXHF-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)S(=O)(=O)C(=CN)C#N |
Computed by PubChem (NCBI)