Products 68386-88-9
CAS 68386-88-9 is the registry number for (1E,4E)-1-(4-Nitrophenyl)-5-phenylpenta-1,4-dien-3-one, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 5g, 10g, 25g.
(1E,4E)-1-(4-nitrophenyl)-5-phenylpenta-1,4-dien-3-one (CAS 68386-88-9) is a chemical compound with the molecular formula C17H13NO3 and a molecular weight of 279.29 g/mol. IUPAC name: (1E,4E)-1-(4-nitrophenyl)-5-phenylpenta-1,4-dien-3-one. InChIKey: VCMMQHPAXNEARO-QHKWOANTSA-N.
| Molecular formula | C17H13NO3 |
|---|---|
| Molecular weight | 279.29 g/mol |
| IUPAC name | (1E,4E)-1-(4-nitrophenyl)-5-phenylpenta-1,4-dien-3-one |
| InChIKey | VCMMQHPAXNEARO-QHKWOANTSA-N |
| SMILES | C1=CC=C(C=C1)/C=C/C(=O)/C=C/C2=CC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)