CAS 68414-86-8 is the registry number for 1-(4-Nitrophenyl)-1,5-dihydro-2h-pyrrol-2-one, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
1-(4-nitrophenyl)-2H-pyrrol-5-one (CAS 68414-86-8) is a chemical compound with the molecular formula C10H8N2O3 and a molecular weight of 204.18 g/mol. IUPAC name: 1-(4-nitrophenyl)-2H-pyrrol-5-one. InChIKey: HJXDJONTGXWGBH-UHFFFAOYSA-N.
| Molecular formula | C10H8N2O3 |
|---|---|
| Molecular weight | 204.18 g/mol |
| IUPAC name | 1-(4-nitrophenyl)-2H-pyrrol-5-one |
| InChIKey | HJXDJONTGXWGBH-UHFFFAOYSA-N |
| SMILES | C1C=CC(=O)N1C2=CC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)