Products 685126-88-9
CAS 685126-88-9 appears in our catalog under these names: 2-Methoxy-5-(trifluoromethyl)benzyl bromide, 95%, 2-Methoxy-5-(trifluoromethyl)benzyl bromide, 97%, 2-Methoxy-5-(trifluoromethyl)benzyl bromide, 98%. Offered by: Combi-blocks, Ambeed, Fluorochem, BLDpharm. Available pack sizes: 250mg, 5g, 1g, 10g.
2-(bromomethyl)-1-methoxy-4-(trifluoromethyl)benzene (CAS 685126-88-9) is a chemical compound with the molecular formula C9H8BrF3O and a molecular weight of 269.06 g/mol. IUPAC name: 2-(bromomethyl)-1-methoxy-4-(trifluoromethyl)benzene. InChIKey: ZGKOXCPOSPRGFQ-UHFFFAOYSA-N.
| Molecular formula | C9H8BrF3O |
|---|---|
| Molecular weight | 269.06 g/mol |
| IUPAC name | 2-(bromomethyl)-1-methoxy-4-(trifluoromethyl)benzene |
| InChIKey | ZGKOXCPOSPRGFQ-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C(F)(F)F)CBr |
Computed by PubChem (NCBI)