CAS 685892-21-1 appears in our catalog under these names: 1-(5-Chloro-2-methoxy-3-nitrophenyl)ethanone, 97%, 5-Chloro-2-methoxy-3-nitroacetophenone, = 99% (GC). Offered by: AmBeed, Fluorochem. Available pack sizes: 25g, 1g, 5g.
1-(5-chloro-2-methoxy-3-nitrophenyl)ethanone (CAS 685892-21-1) is a chemical compound with the molecular formula C9H8ClNO4 and a molecular weight of 229.62 g/mol. IUPAC name: 1-(5-chloro-2-methoxy-3-nitrophenyl)ethanone. InChIKey: LITLMEXLPPVIHU-UHFFFAOYSA-N.
| Molecular formula | C9H8ClNO4 |
|---|---|
| Molecular weight | 229.62 g/mol |
| IUPAC name | 1-(5-chloro-2-methoxy-3-nitrophenyl)ethanone |
| InChIKey | LITLMEXLPPVIHU-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=C(C(=CC(=C1)Cl)[N+](=O)[O-])OC |
Computed by PubChem (NCBI)