CAS 68780-35-8 appears in our catalog under these names: N-Carbamoyl-D-p-hydroxyphenylglycine, N-carbamyl-D-p-hydroxyphenylglycine. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
(2R)-2-(carbamoylamino)-2-(4-hydroxyphenyl)acetic acid (CAS 68780-35-8) is a chemical compound with the molecular formula C9H10N2O4 and a molecular weight of 210.19 g/mol. IUPAC name: (2R)-2-(carbamoylamino)-2-(4-hydroxyphenyl)acetic acid. InChIKey: GSHIDXLOTQDUAV-SSDOTTSWSA-N.
| Molecular formula | C9H10N2O4 |
|---|---|
| Molecular weight | 210.19 g/mol |
| IUPAC name | (2R)-2-(carbamoylamino)-2-(4-hydroxyphenyl)acetic acid |
| InChIKey | GSHIDXLOTQDUAV-SSDOTTSWSA-N |
| SMILES | C1=CC(=CC=C1[C@H](C(=O)O)NC(=O)N)O |
Computed by PubChem (NCBI)