CAS 688318-18-5 is the registry number for 3,5-Diamino-4-phenoxy-benzoic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 50mg, 100mg.
3,5-diamino-4-phenoxybenzoic acid (CAS 688318-18-5) is a chemical compound with the molecular formula C13H12N2O3 and a molecular weight of 244.25 g/mol. IUPAC name: 3,5-diamino-4-phenoxybenzoic acid. InChIKey: IAHCYTJHOGRABZ-UHFFFAOYSA-N.
| Molecular formula | C13H12N2O3 |
|---|---|
| Molecular weight | 244.25 g/mol |
| IUPAC name | 3,5-diamino-4-phenoxybenzoic acid |
| InChIKey | IAHCYTJHOGRABZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OC2=C(C=C(C=C2N)C(=O)O)N |
Computed by PubChem (NCBI)