CAS 689281-03-6 is the registry number for 2-(1,1,3-Trioxo-3,4-dihydro-2H-1λâ¶,4-benzothiazin-2-yl)acetic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-(1,1,3-trioxo-4H-1lambda6,4-benzothiazin-2-yl)acetic acid (CAS 689281-03-6) is a chemical compound with the molecular formula C10H9NO5S and a molecular weight of 255.25 g/mol. IUPAC name: 2-(1,1,3-trioxo-4H-1lambda6,4-benzothiazin-2-yl)acetic acid. InChIKey: MYNNVTRKSKWKNK-UHFFFAOYSA-N.
| Molecular formula | C10H9NO5S |
|---|---|
| Molecular weight | 255.25 g/mol |
| IUPAC name | 2-(1,1,3-trioxo-4H-1lambda6,4-benzothiazin-2-yl)acetic acid |
| InChIKey | MYNNVTRKSKWKNK-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)NC(=O)C(S2(=O)=O)CC(=O)O |
Computed by PubChem (NCBI)