CAS 690631-98-2 appears in our catalog under these names: 5-(3-Hydroxyphenyl)-1h-pyrazole-3-carboxylic acid, 95%, 5-(3-Hydroxyphenyl)-1H-pyrazole-3-carboxylic acid, 97%, 5-(3-Hydroxyphenyl)-1H-pyrazole-3-carboxylic acid, 5-(3-Hydroxyphenyl)-1H-pyrazole-3-carboxylic acid, 97% . Offered by: Combi-blocks, Chemat Brand, Biosynth, Thermo Scientific. Available pack sizes: 100mg, 1g, on request, 0,5g, 250MG, 0,25g.
3-(3-hydroxyphenyl)-1H-pyrazole-5-carboxylic acid (CAS 690631-98-2) is a chemical compound with the molecular formula C10H8N2O3 and a molecular weight of 204.18 g/mol. IUPAC name: 3-(3-hydroxyphenyl)-1H-pyrazole-5-carboxylic acid. InChIKey: KOWRVFWZCLHEIU-UHFFFAOYSA-N.
| Molecular formula | C10H8N2O3 |
|---|---|
| Molecular weight | 204.18 g/mol |
| IUPAC name | 3-(3-hydroxyphenyl)-1H-pyrazole-5-carboxylic acid |
| InChIKey | KOWRVFWZCLHEIU-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)O)C2=NNC(=C2)C(=O)O |
Computed by PubChem (NCBI)